Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 99395-88-7, Name is (S)-4-Phenyloxazolidin-2-one, SMILES is [C@H]1(NC(OC1)=O)C2=CC=CC=C2, belongs to oxazolidines compound. In a document, author is Sanguinet, Lionel, introduce the new discover, Formula: C9H9NO2.
Dithienylethene-Based Gated Ambichromic Dyads
A set of dithienylethene (DTE)-based ambichromic dyads containing an acido-, photo-, and electrosensitive indolino[2,1-b] oxazolidine (BOX) unit displays gated photochromism. Ring opening of BOX prevents photoinduced electrocylization between open and closed forms of DTE. The photochromic performances are regenerated by two different pathways. NMR and electrochemical studies evidence interactions between indolenium and phenyl-thienyl sidearms.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 99395-88-7 is helpful to your research. Formula: C9H9NO2.
Reference:
Oxazolidine – Wikipedia,
,Oxazolidine | C3H7NO – PubChem